C11H24OSi — CID 91703112
[(1R,2R)-2-ethoxycyclohexyl]-trimethylsilane (PubChem CID 91703112) has the molecular formula C11H24OSi and a molecular weight of 200.40 g/mol. Its IUPAC name is [(1R,2R)-2-ethoxycyclohexyl]-trimethylsilane.
| Compound Name | [(1R,2R)-2-ethoxycyclohexyl]-trimethylsilane |
|---|---|
| PubChem CID | 91703112 |
| Molecular Formula | C11H24OSi |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | [(1R,2R)-2-ethoxycyclohexyl]-trimethylsilane |
| SMILES | CCO[C@@H]1CCCC[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C11H24OSi/c1-5-12-10-8-6-7-9-11(10)13(2,3)4/h10-11H,5-9H2,1-4H3/t10-,11-/m1/s1 |
| InChIKey | YTHSCFIBDNYONH-GHMZBOCLSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|