C8H18N2O — CID 124537767
[(1R,2S)-2-ethoxycyclohexyl]hydrazine (PubChem CID 124537767) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is [(1R,2S)-2-ethoxycyclohexyl]hydrazine.
| Compound Name | [(1R,2S)-2-ethoxycyclohexyl]hydrazine |
|---|---|
| PubChem CID | 124537767 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | [(1R,2S)-2-ethoxycyclohexyl]hydrazine |
| SMILES | CCO[C@H]1CCCC[C@H]1NN |
| InChI | InChI=1S/C8H18N2O/c1-2-11-8-6-4-3-5-7(8)10-9/h7-8,10H,2-6,9H2,1H3/t7-,8+/m1/s1 |
| InChIKey | MXEJWNLUJQMCNU-SFYZADRCSA-N |
| XLogP | 0.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|