C20H36O — CID 57180089
7-[(1R,2S)-2-octylcyclopentyl]hept-3-enal (PubChem CID 57180089) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is 7-[(1R,2S)-2-octylcyclopentyl]hept-3-enal.
| Compound Name | 7-[(1R,2S)-2-octylcyclopentyl]hept-3-enal |
|---|---|
| PubChem CID | 57180089 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 7-[(1R,2S)-2-octylcyclopentyl]hept-3-enal |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CCCC=CCC=O |
| InChI | InChI=1S/C20H36O/c1-2-3-4-5-7-10-14-19-16-13-17-20(19)15-11-8-6-9-12-18-21/h6,9,18-20H,2-5,7-8,10-17H2,1H3/t19-,20-/m0/s1 |
| InChIKey | IZAPIABBXKORLW-PMACEKPBSA-N |
| XLogP | 6.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|