C23H46N2O — CID 172785883
(E)-7-[(1S,2S)-2-octylcyclopentyl]hept-2-enamide;propan-1-amine (PubChem CID 172785883) has the molecular formula C23H46N2O and a molecular weight of 366.63 g/mol. Its IUPAC name is (E)-7-[(1S,2S)-2-octylcyclopentyl]hept-2-enamide;propan-1-amine.
| Compound Name | (E)-7-[(1S,2S)-2-octylcyclopentyl]hept-2-enamide;propan-1-amine |
|---|---|
| PubChem CID | 172785883 |
| Molecular Formula | C23H46N2O |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.36 |
| IUPAC Name | (E)-7-[(1S,2S)-2-octylcyclopentyl]hept-2-enamide;propan-1-amine |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1CCCC/C=C/C(N)=O.CCCN |
| InChI | InChI=1S/C20H37NO.C3H9N/c1-2-3-4-5-6-9-13-18-15-12-16-19(18)14-10-7-8-11-17-20(21)22;1-2-3-4/h11,17-19H,2-10,12-16H2,1H3,(H2,21,22);2-4H2,1H3/b17-11+;/t18-,19-;/m0./s1 |
| InChIKey | OWPFNQLWTMJIEO-NDXZRRCTSA-N |
| XLogP | 6.11 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|