C56H94MgO4 — CID 88823516
magnesium bis(2-[5-[(1R,2S)-2-octylcyclopentyl]pent-2-enylidene]dec-3-enoate) (PubChem CID 88823516) has the molecular formula C56H94MgO4 and a molecular weight of 855.67 g/mol. Its IUPAC name is magnesium bis(2-[5-[(1R,2S)-2-octylcyclopentyl]pent-2-enylidene]dec-3-enoate).
| Compound Name | magnesium bis(2-[5-[(1R,2S)-2-octylcyclopentyl]pent-2-enylidene]dec-3-enoate) |
|---|---|
| PubChem CID | 88823516 |
| Molecular Formula | C56H94MgO4 |
| Molecular Weight | 855.67 g/mol |
| Exact Mass | 854.70 |
| IUPAC Name | magnesium bis(2-[5-[(1R,2S)-2-octylcyclopentyl]pent-2-enylidene]dec-3-enoate) |
| SMILES | CCCCCCC=CC(=CC=CCC[C@H]1CCC[C@@H]1CCCCCCCC)C(=O)[O-].CCCCCCC=CC(=CC=CCC[C@H]1CCC[C@@H]1CCCCCCCC)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C28H48O2.Mg/c2*1-3-5-7-9-11-14-19-25-23-18-24-26(25)20-16-13-17-22-27(28(29)30)21-15-12-10-8-6-4-2;/h2*13,15,17,21-22,25-26H,3-12,14,16,18-20,23-24H2,1-2H3,(H,29,30);/q;;+2/p-2/t2*25-,26-;/m00./s1 |
| InChIKey | OVRSZRSWWNEGRH-OMHPTGPQSA-L |
| XLogP | 15.00 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.67 |
| LogP ≤ 5 | 15.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|