C21H36O3 — CID 88813766
7-[(1R,2R)-2-(4-pentoxybutyl)cyclopentyl]hepta-2,4-dienoic acid (PubChem CID 88813766) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4-pentoxybutyl)cyclopentyl]hepta-2,4-dienoic acid.
| Compound Name | 7-[(1R,2R)-2-(4-pentoxybutyl)cyclopentyl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88813766 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 7-[(1R,2R)-2-(4-pentoxybutyl)cyclopentyl]hepta-2,4-dienoic acid |
| SMILES | CCCCCOCCCC[C@H]1CCC[C@@H]1CCC=CC=CC(=O)O |
| InChI | InChI=1S/C21H36O3/c1-2-3-9-17-24-18-10-8-13-20-15-11-14-19(20)12-6-4-5-7-16-21(22)23/h4-5,7,16,19-20H,2-3,6,8-15,17-18H2,1H3,(H,22,23)/t19-,20-/m0/s1 |
| InChIKey | OZFOEGHFXPYDKB-PMACEKPBSA-N |
| XLogP | 5.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|