C19H32O3 — CID 160791248
5-[[(1S,2S)-2-octylcyclopentyl]methoxy]penta-2,4-dienoic acid (PubChem CID 160791248) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 5-[[(1S,2S)-2-octylcyclopentyl]methoxy]penta-2,4-dienoic acid.
| Compound Name | 5-[[(1S,2S)-2-octylcyclopentyl]methoxy]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 160791248 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 5-[[(1S,2S)-2-octylcyclopentyl]methoxy]penta-2,4-dienoic acid |
| SMILES | CCCCCCCC[C@H]1CCC[C@@H]1COC=CC=CC(=O)O |
| InChI | InChI=1S/C19H32O3/c1-2-3-4-5-6-7-11-17-12-10-13-18(17)16-22-15-9-8-14-19(20)21/h8-9,14-15,17-18H,2-7,10-13,16H2,1H3,(H,20,21)/t17-,18+/m0/s1 |
| InChIKey | SBVTYPRYEKTMFJ-ZWKOTPCHSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|