C20H34O3 — CID 54023091
7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]hepta-2,4-dienoic acid (PubChem CID 54023091) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]hepta-2,4-dienoic acid.
| Compound Name | 7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54023091 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 7-[(1R,2S,5S)-2-hydroxy-5-octylcyclopentyl]hepta-2,4-dienoic acid |
| SMILES | CCCCCCCC[C@H]1CC[C@H](O)[C@@H]1CCC=CC=CC(=O)O |
| InChI | InChI=1S/C20H34O3/c1-2-3-4-5-6-9-12-17-15-16-19(21)18(17)13-10-7-8-11-14-20(22)23/h7-8,11,14,17-19,21H,2-6,9-10,12-13,15-16H2,1H3,(H,22,23)/t17-,18+,19-/m0/s1 |
| InChIKey | LAHIIWMFKZHIAD-OTWHNJEPSA-N |
| XLogP | 5.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|