C19H34O4 — CID 54494320
7-[(3R,4S)-4-(2-hexoxyethyl)oxolan-3-yl]hept-2-enoic acid (PubChem CID 54494320) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is 7-[(3R,4S)-4-(2-hexoxyethyl)oxolan-3-yl]hept-2-enoic acid.
| Compound Name | 7-[(3R,4S)-4-(2-hexoxyethyl)oxolan-3-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 54494320 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | 7-[(3R,4S)-4-(2-hexoxyethyl)oxolan-3-yl]hept-2-enoic acid |
| SMILES | CCCCCCOCC[C@@H]1COC[C@@H]1CCCCC=CC(=O)O |
| InChI | InChI=1S/C19H34O4/c1-2-3-4-9-13-22-14-12-18-16-23-15-17(18)10-7-5-6-8-11-19(20)21/h8,11,17-18H,2-7,9-10,12-16H2,1H3,(H,20,21)/t17-,18+/m0/s1 |
| InChIKey | XXZDUXCJBRVQMP-ZWKOTPCHSA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|