C20H34O5 — CID 70478357
(E)-4-[2-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]but-2-enoic acid (PubChem CID 70478357) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is (E)-4-[2-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]but-2-enoic acid.
| Compound Name | (E)-4-[2-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 70478357 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (E)-4-[2-[(1S,2S,3R,4R)-3-(2-hexoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]but-2-enoic acid |
| SMILES | CCCCCCOCC[C@@H]1[C@H](CCOC/C=C/C(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C20H34O5/c1-2-3-4-5-12-23-14-10-16-17(19-9-8-18(16)25-19)11-15-24-13-6-7-20(21)22/h6-7,16-19H,2-5,8-15H2,1H3,(H,21,22)/b7-6+/t16-,17+,18-,19+/m1/s1 |
| InChIKey | JXUZHPZTAFWABL-GIZGKNGMSA-N |
| XLogP | 3.81 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|