C18H30O5 — CID 18599947
(E)-4-[[(1S,2R,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]but-2-enoic acid (PubChem CID 18599947) has the molecular formula C18H30O5 and a molecular weight of 326.43 g/mol. Its IUPAC name is (E)-4-[[(1S,2R,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]but-2-enoic acid.
| Compound Name | (E)-4-[[(1S,2R,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 18599947 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | (E)-4-[[(1S,2R,3S,4R)-3-(hexoxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]but-2-enoic acid |
| SMILES | CCCCCCOC[C@@H]1[C@H](COC/C=C/C(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C18H30O5/c1-2-3-4-5-10-21-12-14-15(17-9-8-16(14)23-17)13-22-11-6-7-18(19)20/h6-7,14-17H,2-5,8-13H2,1H3,(H,19,20)/b7-6+/t14-,15+,16-,17+/m1/s1 |
| InChIKey | INNJLXCSAXUQAU-UWVJSXRGSA-N |
| XLogP | 3.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|