C16H26O5 — CID 18599966
5-[[(1S,2R,3R,4R)-3-(4-oxobutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid (PubChem CID 18599966) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is 5-[[(1S,2R,3R,4R)-3-(4-oxobutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid.
| Compound Name | 5-[[(1S,2R,3R,4R)-3-(4-oxobutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid |
|---|---|
| PubChem CID | 18599966 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 5-[[(1S,2R,3R,4R)-3-(4-oxobutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid |
| SMILES | O=CCCC[C@@H]1[C@H](COCCCCC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C16H26O5/c17-9-3-1-5-12-13(15-8-7-14(12)21-15)11-20-10-4-2-6-16(18)19/h9,12-15H,1-8,10-11H2,(H,18,19)/t12-,13+,14-,15+/m1/s1 |
| InChIKey | RMOKHIOCNUOLIB-BARDWOONSA-N |
| XLogP | 2.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|