C13H22O5 — CID 54542162
5-[[(1R,2S,3R,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid (PubChem CID 54542162) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 5-[[(1R,2S,3R,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid.
| Compound Name | 5-[[(1R,2S,3R,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid |
|---|---|
| PubChem CID | 54542162 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-[[(1R,2S,3R,4S)-3-(hydroxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid |
| SMILES | O=C(O)CCCCOC[C@@H]1[C@H](CO)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C13H22O5/c14-7-9-10(12-5-4-11(9)18-12)8-17-6-2-1-3-13(15)16/h9-12,14H,1-8H2,(H,15,16)/t9-,10+,11-,12+/m0/s1 |
| InChIKey | ZDZIAYPLTGWIMN-WHOHXGKFSA-N |
| XLogP | 1.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|