C22H38O5 — CID 54203153
5-[[(1R,2S,3S,4S)-3-(3-hydroxy-4,4-dimethyloct-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid (PubChem CID 54203153) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 5-[[(1R,2S,3S,4S)-3-(3-hydroxy-4,4-dimethyloct-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid.
| Compound Name | 5-[[(1R,2S,3S,4S)-3-(3-hydroxy-4,4-dimethyloct-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid |
|---|---|
| PubChem CID | 54203153 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 5-[[(1R,2S,3S,4S)-3-(3-hydroxy-4,4-dimethyloct-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]pentanoic acid |
| SMILES | CCCCC(C)(C)C(O)C=C[C@H]1[C@@H](COCCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H38O5/c1-4-5-13-22(2,3)20(23)12-9-16-17(19-11-10-18(16)27-19)15-26-14-7-6-8-21(24)25/h9,12,16-20,23H,4-8,10-11,13-15H2,1-3H3,(H,24,25)/t16-,17+,18-,19+,20?/m0/s1 |
| InChIKey | PQQIKTNKFKFFLV-HFKIYIHZSA-N |
| XLogP | 4.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|