C26H44O7 — CID 57061864
4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoxy]-4-oxobutanoic acid (PubChem CID 57061864) has the molecular formula C26H44O7 and a molecular weight of 468.63 g/mol. Its IUPAC name is 4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoxy]-4-oxobutanoic acid.
| Compound Name | 4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57061864 |
| Molecular Formula | C26H44O7 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | 4-[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4,4-dimethyloct-1-enyl]cyclopentyl]hept-5-enoxy]-4-oxobutanoic acid |
| SMILES | CCCCC(C)(C)[C@H](O)C=C[C@@H]1[C@@H](CC=CCCCCOC(=O)CCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C26H44O7/c1-4-5-16-26(2,3)23(29)13-12-20-19(21(27)18-22(20)28)11-9-7-6-8-10-17-33-25(32)15-14-24(30)31/h7,9,12-13,19-23,27-29H,4-6,8,10-11,14-18H2,1-3H3,(H,30,31)/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | OHVOPATVNZTJME-XNBWIAOKSA-N |
| XLogP | 4.00 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|