C20H35NO5 — CID 54235287
5-[[(1S,2R,3S,4R)-3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]-N-hydroxy-N-methylpentanamide (PubChem CID 54235287) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is 5-[[(1S,2R,3S,4R)-3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]-N-hydroxy-N-methylpentanamide.
| Compound Name | 5-[[(1S,2R,3S,4R)-3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]-N-hydroxy-N-methylpentanamide |
|---|---|
| PubChem CID | 54235287 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 5-[[(1S,2R,3S,4R)-3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]-N-hydroxy-N-methylpentanamide |
| SMILES | CN(O)C(=O)CCCCOC[C@H]1[C@@H](COC2CCCCC2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C20H35NO5/c1-21(23)20(22)9-5-6-12-24-13-16-17(19-11-10-18(16)26-19)14-25-15-7-3-2-4-8-15/h15-19,23H,2-14H2,1H3/t16-,17+,18-,19+/m0/s1 |
| InChIKey | QMCYIHRGWPVFGB-ZSYWTGECSA-N |
| XLogP | 3.16 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|