C10H19NO2 — CID 89427272
2-cyclohexyloxy-N,N-dimethylacetamide (PubChem CID 89427272) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-cyclohexyloxy-N,N-dimethylacetamide.
| Compound Name | 2-cyclohexyloxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 89427272 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-cyclohexyloxy-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COC1CCCCC1 |
| InChI | InChI=1S/C10H19NO2/c1-11(2)10(12)8-13-9-6-4-3-5-7-9/h9H,3-8H2,1-2H3 |
| InChIKey | ZBFHDDGZQMTPMH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |