About 2-cyclododecyloxyacetic acid
2-cyclododecyloxyacetic acid (PubChem CID 19371812) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-cyclododecyloxyacetic acid.
Molecular Properties
| Compound Name | 2-cyclododecyloxyacetic acid |
| PubChem CID | 19371812 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-cyclododecyloxyacetic acid |
| SMILES | O=C(O)COC1CCCCCCCCCCC1 |
| InChI | InChI=1S/C14H26O3/c15-14(16)12-17-13-10-8-6-4-2-1-3-5-7-9-11-13/h13H,1-12H2,(H,15,16) |
| InChIKey | GQEQLRQVQDHQAD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclododecyloxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclododecyloxyacetic acid?
The IUPAC name of 2-cyclododecyloxyacetic acid (CID 19371812) is 2-cyclododecyloxyacetic acid.
What is the SMILES notation for 2-cyclododecyloxyacetic acid?
The canonical SMILES for 2-cyclododecyloxyacetic acid is O=C(O)COC1CCCCCCCCCCC1.
What is the InChIKey of 2-cyclododecyloxyacetic acid?
The InChIKey is GQEQLRQVQDHQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c15-14(16)12-17-13-10-8-6-4-2-1-3-5-7-9-11-13/h13H,1-12H2,(H,15,16).
What are the key properties of 2-cyclododecyloxyacetic acid?
2-cyclododecyloxyacetic acid has a molecular weight of 242.36 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclododecyloxyacetic acid is sourced from PubChem (CID 19371812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).