C12H20F3NO2 — CID 78888415
2-cyclohexyloxy-N-ethyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 78888415) has the molecular formula C12H20F3NO2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-ethyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-cyclohexyloxy-N-ethyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 78888415 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-cyclohexyloxy-N-ethyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN(CC(F)(F)F)C(=O)COC1CCCCC1 |
| InChI | InChI=1S/C12H20F3NO2/c1-2-16(9-12(13,14)15)11(17)8-18-10-6-4-3-5-7-10/h10H,2-9H2,1H3 |
| InChIKey | KRYPLSUOWHQZGW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |