C20H35NO4S — CID 56985983
5-[[3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxyhexanamide (PubChem CID 56985983) has the molecular formula C20H35NO4S and a molecular weight of 385.57 g/mol. Its IUPAC name is 5-[[3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxyhexanamide.
| Compound Name | 5-[[3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 56985983 |
| Molecular Formula | C20H35NO4S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 5-[[3-(cyclohexyloxymethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methylsulfanyl]-N-hydroxyhexanamide |
| SMILES | CC(CCCC(=O)NO)SCC1C2CCC(O2)C1COC1CCCCC1 |
| InChI | InChI=1S/C20H35NO4S/c1-14(6-5-9-20(22)21-23)26-13-17-16(18-10-11-19(17)25-18)12-24-15-7-3-2-4-8-15/h14-19,23H,2-13H2,1H3,(H,21,22) |
| InChIKey | PDTWVNKUGXHMIF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|