C18H33NO5 — CID 57063471
N-hydroxy-5-[[3-(2-propoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide (PubChem CID 57063471) has the molecular formula C18H33NO5 and a molecular weight of 343.46 g/mol. Its IUPAC name is N-hydroxy-5-[[3-(2-propoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide.
| Compound Name | N-hydroxy-5-[[3-(2-propoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide |
|---|---|
| PubChem CID | 57063471 |
| Molecular Formula | C18H33NO5 |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | N-hydroxy-5-[[3-(2-propoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methoxy]hexanamide |
| SMILES | CCCOCCC1C2CCC(O2)C1COC(C)CCCC(=O)NO |
| InChI | InChI=1S/C18H33NO5/c1-3-10-22-11-9-14-15(17-8-7-16(14)24-17)12-23-13(2)5-4-6-18(20)19-21/h13-17,21H,3-12H2,1-2H3,(H,19,20) |
| InChIKey | JAFDOPSNTRPOPC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|