C21H39NO3S2 — CID 57300998
5-[2-[3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxyhexanamide (PubChem CID 57300998) has the molecular formula C21H39NO3S2 and a molecular weight of 417.68 g/mol. Its IUPAC name is 5-[2-[3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxyhexanamide.
| Compound Name | 5-[2-[3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 57300998 |
| Molecular Formula | C21H39NO3S2 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 5-[2-[3-(hexylsulfanylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethylsulfanyl]-N-hydroxyhexanamide |
| SMILES | CCCCCCSCC1C2CCC(O2)C1CCSC(C)CCCC(=O)NO |
| InChI | InChI=1S/C21H39NO3S2/c1-3-4-5-6-13-26-15-18-17(19-10-11-20(18)25-19)12-14-27-16(2)8-7-9-21(23)22-24/h16-20,24H,3-15H2,1-2H3,(H,22,23) |
| InChIKey | MMBBGQQRJBDAID-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|