C23H41NO3S — CID 54531478
7-[(1S,2S,3R,4R)-3-(2-hexylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide (PubChem CID 54531478) has the molecular formula C23H41NO3S and a molecular weight of 411.65 g/mol. Its IUPAC name is 7-[(1S,2S,3R,4R)-3-(2-hexylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide.
| Compound Name | 7-[(1S,2S,3R,4R)-3-(2-hexylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 54531478 |
| Molecular Formula | C23H41NO3S |
| Molecular Weight | 411.65 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 7-[(1S,2S,3R,4R)-3-(2-hexylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-2,2-dimethylhept-5-enamide |
| SMILES | CCCCCCSCC[C@@H]1[C@H](CC=CCCC(C)(C)C(=O)NO)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H41NO3S/c1-4-5-6-10-16-28-17-14-19-18(20-12-13-21(19)27-20)11-8-7-9-15-23(2,3)22(25)24-26/h7-8,18-21,26H,4-6,9-17H2,1-3H3,(H,24,25)/t18-,19+,20-,21+/m0/s1 |
| InChIKey | YWWHLDNEMRRSHO-JSXRDJHFSA-N |
| XLogP | 5.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|