C27H45NO3S — CID 88659629
(Z)-7-[(1S,2S,3R,4R)-3-(4-hept-6-ynylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-N,2,2-trimethylhept-5-enamide (PubChem CID 88659629) has the molecular formula C27H45NO3S and a molecular weight of 463.73 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-(4-hept-6-ynylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-N,2,2-trimethylhept-5-enamide.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-(4-hept-6-ynylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-N,2,2-trimethylhept-5-enamide |
|---|---|
| PubChem CID | 88659629 |
| Molecular Formula | C27H45NO3S |
| Molecular Weight | 463.73 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-(4-hept-6-ynylsulfanylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]-N-hydroxy-N,2,2-trimethylhept-5-enamide |
| SMILES | C#CCCCCCSCCCC[C@@H]1[C@H](C/C=C\CCC(C)(C)C(=O)N(C)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C27H45NO3S/c1-5-6-7-8-13-20-32-21-14-11-16-23-22(24-17-18-25(23)31-24)15-10-9-12-19-27(2,3)26(29)28(4)30/h1,9-10,22-25,30H,6-8,11-21H2,2-4H3/b10-9-/t22-,23+,24-,25+/m0/s1 |
| InChIKey | GNJXWSZSOZMSSZ-IPBWSONFSA-N |
| XLogP | 6.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.73 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|