C18H31NO4S — CID 88659643
(Z)-N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide (PubChem CID 88659643) has the molecular formula C18H31NO4S and a molecular weight of 357.52 g/mol. Its IUPAC name is (Z)-N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide.
| Compound Name | (Z)-N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
|---|---|
| PubChem CID | 88659643 |
| Molecular Formula | C18H31NO4S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (Z)-N-hydroxy-N,2,2-trimethyl-7-[(1S,2S,3R,4R)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
| SMILES | CN(O)C(=O)C(C)(C)CC/C=C\C[C@H]1[C@@H](CS(C)=O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C18H31NO4S/c1-18(2,17(20)19(3)21)11-7-5-6-8-13-14(12-24(4)22)16-10-9-15(13)23-16/h5-6,13-16,21H,7-12H2,1-4H3/b6-5-/t13-,14+,15-,16+,24?/m0/s1 |
| InChIKey | DADHIDTWURMWCL-BZOCEBGVSA-N |
| XLogP | 2.76 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|