C24H35NO4 — CID 54393506
N-hydroxy-2,2-dimethyl-7-[(1R,2R,3S,4S)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide (PubChem CID 54393506) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethyl-7-[(1R,2R,3S,4S)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide.
| Compound Name | N-hydroxy-2,2-dimethyl-7-[(1R,2R,3S,4S)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
|---|---|
| PubChem CID | 54393506 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | N-hydroxy-2,2-dimethyl-7-[(1R,2R,3S,4S)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enamide |
| SMILES | CC(C)(CCC=CC[C@@H]1[C@H](CCOCc2ccccc2)[C@@H]2CC[C@H]1O2)C(=O)NO |
| InChI | InChI=1S/C24H35NO4/c1-24(2,23(26)25-27)15-8-4-7-11-19-20(22-13-12-21(19)29-22)14-16-28-17-18-9-5-3-6-10-18/h3-7,9-10,19-22,27H,8,11-17H2,1-2H3,(H,25,26)/t19-,20+,21-,22+/m1/s1 |
| InChIKey | VIHWMYMZICNJBC-MBDNFAEBSA-N |
| XLogP | 4.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|