C14H22N2O5S — CID 18723044
N-hydroxy-2-methyl-2-(3-phenylmethoxypropylsulfamoyl)propanamide (PubChem CID 18723044) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-(3-phenylmethoxypropylsulfamoyl)propanamide.
| Compound Name | N-hydroxy-2-methyl-2-(3-phenylmethoxypropylsulfamoyl)propanamide |
|---|---|
| PubChem CID | 18723044 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-hydroxy-2-methyl-2-(3-phenylmethoxypropylsulfamoyl)propanamide |
| SMILES | CC(C)(C(=O)NO)S(=O)(=O)NCCCOCc1ccccc1 |
| InChI | InChI=1S/C14H22N2O5S/c1-14(2,13(17)16-18)22(19,20)15-9-6-10-21-11-12-7-4-3-5-8-12/h3-5,7-8,15,18H,6,9-11H2,1-2H3,(H,16,17) |
| InChIKey | ZBNMVUNCKKLNJC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|