C17H17Cl2NO5S — CID 113223258
2,5-dichloro-3-(3-phenylmethoxypropylsulfamoyl)benzoic acid (PubChem CID 113223258) has the molecular formula C17H17Cl2NO5S and a molecular weight of 418.30 g/mol. Its IUPAC name is 2,5-dichloro-3-(3-phenylmethoxypropylsulfamoyl)benzoic acid.
| Compound Name | 2,5-dichloro-3-(3-phenylmethoxypropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 113223258 |
| Molecular Formula | C17H17Cl2NO5S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 2,5-dichloro-3-(3-phenylmethoxypropylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)NCCCOCc2ccccc2)c1Cl |
| InChI | InChI=1S/C17H17Cl2NO5S/c18-13-9-14(17(21)22)16(19)15(10-13)26(23,24)20-7-4-8-25-11-12-5-2-1-3-6-12/h1-3,5-6,9-10,20H,4,7-8,11H2,(H,21,22) |
| InChIKey | SUKXDKNSLQUAGP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|