C17H21NO6S — CID 122198787
2,5-dimethyl-4-(3-phenylmethoxypropylsulfamoyl)furan-3-carboxylic acid (PubChem CID 122198787) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is 2,5-dimethyl-4-(3-phenylmethoxypropylsulfamoyl)furan-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-4-(3-phenylmethoxypropylsulfamoyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 122198787 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2,5-dimethyl-4-(3-phenylmethoxypropylsulfamoyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCCOCc2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C17H21NO6S/c1-12-15(17(19)20)16(13(2)24-12)25(21,22)18-9-6-10-23-11-14-7-4-3-5-8-14/h3-5,7-8,18H,6,9-11H2,1-2H3,(H,19,20) |
| InChIKey | ZGAVJILRKRPIBN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|