C12H15NO5S — CID 106220027
2,5-dimethyl-4-(pent-4-ynylsulfamoyl)furan-3-carboxylic acid (PubChem CID 106220027) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2,5-dimethyl-4-(pent-4-ynylsulfamoyl)furan-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-4-(pent-4-ynylsulfamoyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 106220027 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2,5-dimethyl-4-(pent-4-ynylsulfamoyl)furan-3-carboxylic acid |
| SMILES | C#CCCCNS(=O)(=O)c1c(C)oc(C)c1C(=O)O |
| InChI | InChI=1S/C12H15NO5S/c1-4-5-6-7-13-19(16,17)11-9(3)18-8(2)10(11)12(14)15/h1,13H,5-7H2,2-3H3,(H,14,15) |
| InChIKey | DROAWNMJIDWSLY-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|