C11H17NO7S2 — CID 61020522
2,5-dimethyl-4-(3-methylsulfonylpropylsulfamoyl)furan-3-carboxylic acid (PubChem CID 61020522) has the molecular formula C11H17NO7S2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2,5-dimethyl-4-(3-methylsulfonylpropylsulfamoyl)furan-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-4-(3-methylsulfonylpropylsulfamoyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 61020522 |
| Molecular Formula | C11H17NO7S2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2,5-dimethyl-4-(3-methylsulfonylpropylsulfamoyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCCS(C)(=O)=O)c1C(=O)O |
| InChI | InChI=1S/C11H17NO7S2/c1-7-9(11(13)14)10(8(2)19-7)21(17,18)12-5-4-6-20(3,15)16/h12H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | KNCPVQVEJWZESW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|