C10H16N2O7S2 — CID 43546086
4-[2-(methanesulfonamido)ethylsulfamoyl]-2,5-dimethylfuran-3-carboxylic acid (PubChem CID 43546086) has the molecular formula C10H16N2O7S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[2-(methanesulfonamido)ethylsulfamoyl]-2,5-dimethylfuran-3-carboxylic acid.
| Compound Name | 4-[2-(methanesulfonamido)ethylsulfamoyl]-2,5-dimethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 43546086 |
| Molecular Formula | C10H16N2O7S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-[2-(methanesulfonamido)ethylsulfamoyl]-2,5-dimethylfuran-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCNS(C)(=O)=O)c1C(=O)O |
| InChI | InChI=1S/C10H16N2O7S2/c1-6-8(10(13)14)9(7(2)19-6)21(17,18)12-5-4-11-20(3,15)16/h11-12H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | ZYJFQPJPIYKGCE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|