C11H16N2O6S — CID 60864108
4-[(4-amino-4-oxobutyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid (PubChem CID 60864108) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 4-[(4-amino-4-oxobutyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid.
| Compound Name | 4-[(4-amino-4-oxobutyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 60864108 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-[(4-amino-4-oxobutyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCCC(N)=O)c1C(=O)O |
| InChI | InChI=1S/C11H16N2O6S/c1-6-9(11(15)16)10(7(2)19-6)20(17,18)13-5-3-4-8(12)14/h13H,3-5H2,1-2H3,(H2,12,14)(H,15,16) |
| InChIKey | FEULODCBGXIFAX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|