C13H21NO6S — CID 106155956
4-[(5-hydroxy-4-methylpentyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid (PubChem CID 106155956) has the molecular formula C13H21NO6S and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-[(5-hydroxy-4-methylpentyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid.
| Compound Name | 4-[(5-hydroxy-4-methylpentyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 106155956 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-[(5-hydroxy-4-methylpentyl)sulfamoyl]-2,5-dimethylfuran-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCCC(C)CO)c1C(=O)O |
| InChI | InChI=1S/C13H21NO6S/c1-8(7-15)5-4-6-14-21(18,19)12-10(3)20-9(2)11(12)13(16)17/h8,14-15H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | LWJJSMHWEXEGID-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|