C12H15Cl2NO5S — CID 106120585
2,5-dichloro-3-(4-hydroxypentylsulfamoyl)benzoic acid (PubChem CID 106120585) has the molecular formula C12H15Cl2NO5S and a molecular weight of 356.23 g/mol. Its IUPAC name is 2,5-dichloro-3-(4-hydroxypentylsulfamoyl)benzoic acid.
| Compound Name | 2,5-dichloro-3-(4-hydroxypentylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 106120585 |
| Molecular Formula | C12H15Cl2NO5S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2,5-dichloro-3-(4-hydroxypentylsulfamoyl)benzoic acid |
| SMILES | CC(O)CCCNS(=O)(=O)c1cc(Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C12H15Cl2NO5S/c1-7(16)3-2-4-15-21(19,20)10-6-8(13)5-9(11(10)14)12(17)18/h5-7,15-16H,2-4H2,1H3,(H,17,18) |
| InChIKey | JQYNGACFCJYSFI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|