C20H33NO4 — CID 143391209
tert-butyl N-[(2R,3R)-2-(2-phenylmethoxyethyl)oxolan-3-yl]carbamate;ethane (PubChem CID 143391209) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R)-2-(2-phenylmethoxyethyl)oxolan-3-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[(2R,3R)-2-(2-phenylmethoxyethyl)oxolan-3-yl]carbamate;ethane |
|---|---|
| PubChem CID | 143391209 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | tert-butyl N-[(2R,3R)-2-(2-phenylmethoxyethyl)oxolan-3-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N[C@@H]1CCO[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C18H27NO4.C2H6/c1-18(2,3)23-17(20)19-15-9-12-22-16(15)10-11-21-13-14-7-5-4-6-8-14;1-2/h4-8,15-16H,9-13H2,1-3H3,(H,19,20);1-2H3/t15-,16-;/m1./s1 |
| InChIKey | WIHBAAYSSOXZAL-QNBGGDODSA-N |
| XLogP | 4.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|