C23H35NO4 — CID 140644876
tert-butyl N-[3-oxo-1-[4-(2-phenylmethoxyethyl)cyclohexyl]propyl]carbamate (PubChem CID 140644876) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-1-[4-(2-phenylmethoxyethyl)cyclohexyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-1-[4-(2-phenylmethoxyethyl)cyclohexyl]propyl]carbamate |
|---|---|
| PubChem CID | 140644876 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | tert-butyl N-[3-oxo-1-[4-(2-phenylmethoxyethyl)cyclohexyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC=O)C1CCC(CCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H35NO4/c1-23(2,3)28-22(26)24-21(13-15-25)20-11-9-18(10-12-20)14-16-27-17-19-7-5-4-6-8-19/h4-8,15,18,20-21H,9-14,16-17H2,1-3H3,(H,24,26) |
| InChIKey | ZQBMJBRSPFPUPH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|