C24H35NO5 — CID 58351873
benzyl (3R)-3-formyl-4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]butanoate (PubChem CID 58351873) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is benzyl (3R)-3-formyl-4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]butanoate.
| Compound Name | benzyl (3R)-3-formyl-4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]butanoate |
|---|---|
| PubChem CID | 58351873 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | benzyl (3R)-3-formyl-4-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexyl]butanoate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C[C@@H](C=O)CC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H35NO5/c1-24(2,3)30-23(28)25-15-19-11-9-18(10-12-19)13-21(16-26)14-22(27)29-17-20-7-5-4-6-8-20/h4-8,16,18-19,21H,9-15,17H2,1-3H3,(H,25,28)/t18?,19?,21-/m1/s1 |
| InChIKey | WGBJUQVLNZLRRA-GZNCHQMQSA-N |
| XLogP | 4.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|