C23H35NO5 — CID 86752104
tert-butyl N-[(1S)-3,3-dimethyl-1-[(2S)-5-oxooxolan-2-yl]-5-phenylmethoxypentyl]carbamate (PubChem CID 86752104) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3,3-dimethyl-1-[(2S)-5-oxooxolan-2-yl]-5-phenylmethoxypentyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3,3-dimethyl-1-[(2S)-5-oxooxolan-2-yl]-5-phenylmethoxypentyl]carbamate |
|---|---|
| PubChem CID | 86752104 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | tert-butyl N-[(1S)-3,3-dimethyl-1-[(2S)-5-oxooxolan-2-yl]-5-phenylmethoxypentyl]carbamate |
| SMILES | CC(C)(CCOCc1ccccc1)C[C@H](NC(=O)OC(C)(C)C)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C23H35NO5/c1-22(2,3)29-21(26)24-18(19-11-12-20(25)28-19)15-23(4,5)13-14-27-16-17-9-7-6-8-10-17/h6-10,18-19H,11-16H2,1-5H3,(H,24,26)/t18-,19-/m0/s1 |
| InChIKey | SHVCAHVYMBQJCF-OALUTQOASA-N |
| XLogP | 4.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|