C16H27NO4 — CID 68546548
tert-butyl N-[(1S,3S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]hex-5-enyl]carbamate (PubChem CID 68546548) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]hex-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]hex-5-enyl]carbamate |
|---|---|
| PubChem CID | 68546548 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | tert-butyl N-[(1S,3S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]hex-5-enyl]carbamate |
| SMILES | C=CC[C@H](C)C[C@H](NC(=O)OC(C)(C)C)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C16H27NO4/c1-6-7-11(2)10-12(13-8-9-14(18)20-13)17-15(19)21-16(3,4)5/h6,11-13H,1,7-10H2,2-5H3,(H,17,19)/t11-,12-,13-/m0/s1 |
| InChIKey | ICIFWMBVCILVHZ-AVGNSLFASA-N |
| XLogP | 3.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|