C27H37NO5Si — CID 71079575
tert-butyl N-[(1S)-4-[hydroxy(diphenyl)silyl]-4-methyl-1-[(2S)-5-oxooxolan-2-yl]pentyl]carbamate (PubChem CID 71079575) has the molecular formula C27H37NO5Si and a molecular weight of 483.68 g/mol. Its IUPAC name is tert-butyl N-[(1S)-4-[hydroxy(diphenyl)silyl]-4-methyl-1-[(2S)-5-oxooxolan-2-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-4-[hydroxy(diphenyl)silyl]-4-methyl-1-[(2S)-5-oxooxolan-2-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 71079575 |
| Molecular Formula | C27H37NO5Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | tert-butyl N-[(1S)-4-[hydroxy(diphenyl)silyl]-4-methyl-1-[(2S)-5-oxooxolan-2-yl]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C27H37NO5Si/c1-26(2,3)33-25(30)28-22(23-16-17-24(29)32-23)18-19-27(4,5)34(31,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,22-23,31H,16-19H2,1-5H3,(H,28,30)/t22-,23-/m0/s1 |
| InChIKey | ZCGUESDPAGMBMN-GOTSBHOMSA-N |
| XLogP | 3.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|