C25H36INO3Si — CID 67477292
tert-butyl N-[(2R)-6-[hydroxy(diphenyl)silyl]-1-iodo-6-methylheptan-2-yl]carbamate (PubChem CID 67477292) has the molecular formula C25H36INO3Si and a molecular weight of 553.56 g/mol. Its IUPAC name is tert-butyl N-[(2R)-6-[hydroxy(diphenyl)silyl]-1-iodo-6-methylheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-6-[hydroxy(diphenyl)silyl]-1-iodo-6-methylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 67477292 |
| Molecular Formula | C25H36INO3Si |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | tert-butyl N-[(2R)-6-[hydroxy(diphenyl)silyl]-1-iodo-6-methylheptan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CI)CCCC(C)(C)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36INO3Si/c1-24(2,3)30-23(28)27-20(19-26)13-12-18-25(4,5)31(29,21-14-8-6-9-15-21)22-16-10-7-11-17-22/h6-11,14-17,20,29H,12-13,18-19H2,1-5H3,(H,27,28)/t20-/m1/s1 |
| InChIKey | YKASXKLWIKYQTQ-HXUWFJFHSA-N |
| XLogP | 5.02 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|