C13H26INO2 — CID 88586039
tert-butyl N-[(2S,5S)-1-iodo-5-methylheptan-2-yl]carbamate (PubChem CID 88586039) has the molecular formula C13H26INO2 and a molecular weight of 355.26 g/mol. Its IUPAC name is tert-butyl N-[(2S,5S)-1-iodo-5-methylheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,5S)-1-iodo-5-methylheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 88586039 |
| Molecular Formula | C13H26INO2 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | tert-butyl N-[(2S,5S)-1-iodo-5-methylheptan-2-yl]carbamate |
| SMILES | CC[C@H](C)CC[C@@H](CI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26INO2/c1-6-10(2)7-8-11(9-14)15-12(16)17-13(3,4)5/h10-11H,6-9H2,1-5H3,(H,15,16)/t10-,11-/m0/s1 |
| InChIKey | YMGJQKVFGKVILH-QWRGUYRKSA-N |
| XLogP | 4.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|