C14H24INO4 — CID 11784266
ethyl (Z,6S)-7-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate (PubChem CID 11784266) has the molecular formula C14H24INO4 and a molecular weight of 397.25 g/mol. Its IUPAC name is ethyl (Z,6S)-7-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate.
| Compound Name | ethyl (Z,6S)-7-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
|---|---|
| PubChem CID | 11784266 |
| Molecular Formula | C14H24INO4 |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | ethyl (Z,6S)-7-iodo-6-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C\CC[C@@H](CI)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24INO4/c1-5-19-12(17)9-7-6-8-11(10-15)16-13(18)20-14(2,3)4/h7,9,11H,5-6,8,10H2,1-4H3,(H,16,18)/b9-7-/t11-/m0/s1 |
| InChIKey | BIJLFGDBTWNBSM-DVBBHNHCSA-N |
| XLogP | 3.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|