C21H32N2O11 — CID 54584140
4-O-[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl] 1-O-ethyl (E)-but-2-enedioate;(E)-4-ethoxy-4-oxobut-2-enoic acid (PubChem CID 54584140) has the molecular formula C21H32N2O11 and a molecular weight of 488.49 g/mol. Its IUPAC name is 4-O-[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl] 1-O-ethyl (E)-but-2-enedioate;(E)-4-ethoxy-4-oxobut-2-enoic acid.
| Compound Name | 4-O-[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl] 1-O-ethyl (E)-but-2-enedioate;(E)-4-ethoxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54584140 |
| Molecular Formula | C21H32N2O11 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-O-[(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl] 1-O-ethyl (E)-but-2-enedioate;(E)-4-ethoxy-4-oxobut-2-enoic acid |
| SMILES | CCOC(=O)/C=C/C(=O)O.CCOC(=O)/C=C/C(=O)OC[C@H](CC(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O7.C6H8O4/c1-5-22-12(19)6-7-13(20)23-9-10(8-11(16)18)17-14(21)24-15(2,3)4;1-2-10-6(9)4-3-5(7)8/h6-7,10H,5,8-9H2,1-4H3,(H2,16,18)(H,17,21);3-4H,2H2,1H3,(H,7,8)/b7-6+;4-3+/t10-;/m0./s1 |
| InChIKey | AGFVVHVFBVUBCY-CGFMTBAISA-N |
| XLogP | 0.61 |
| TPSA | 197.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|