C21H41NO5Si — CID 132565041
ethyl (E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate (PubChem CID 132565041) has the molecular formula C21H41NO5Si and a molecular weight of 415.65 g/mol. Its IUPAC name is ethyl (E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate.
| Compound Name | ethyl (E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate |
|---|---|
| PubChem CID | 132565041 |
| Molecular Formula | C21H41NO5Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | ethyl (E,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-7-[(2-methylpropan-2-yl)oxycarbonylamino]oct-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H41NO5Si/c1-11-25-18(23)15-13-12-14-17(27-28(9,10)21(6,7)8)16(2)22-19(24)26-20(3,4)5/h13,15-17H,11-12,14H2,1-10H3,(H,22,24)/b15-13+/t16-,17-/m0/s1 |
| InChIKey | KDYBFLYNOKPVNR-LFUXOTAPSA-N |
| XLogP | 5.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|