C23H34N2O5 — CID 70070742
tert-butyl N-[(1S)-2-[3-[hydroxy(pyridin-3-yl)methyl]cyclohexyl]-1-[(2S)-5-oxooxolan-2-yl]ethyl]carbamate (PubChem CID 70070742) has the molecular formula C23H34N2O5 and a molecular weight of 418.53 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[3-[hydroxy(pyridin-3-yl)methyl]cyclohexyl]-1-[(2S)-5-oxooxolan-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[3-[hydroxy(pyridin-3-yl)methyl]cyclohexyl]-1-[(2S)-5-oxooxolan-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70070742 |
| Molecular Formula | C23H34N2O5 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | tert-butyl N-[(1S)-2-[3-[hydroxy(pyridin-3-yl)methyl]cyclohexyl]-1-[(2S)-5-oxooxolan-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1CCCC(C(O)c2cccnc2)C1)[C@@H]1CCC(=O)O1 |
| InChI | InChI=1S/C23H34N2O5/c1-23(2,3)30-22(28)25-18(19-9-10-20(26)29-19)13-15-6-4-7-16(12-15)21(27)17-8-5-11-24-14-17/h5,8,11,14-16,18-19,21,27H,4,6-7,9-10,12-13H2,1-3H3,(H,25,28)/t15?,16?,18-,19-,21?/m0/s1 |
| InChIKey | DRYPYCMBXYWHBC-CVVYKNHESA-N |
| XLogP | 3.91 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |