C16H27NO5 — CID 87490293
tert-butyl N-[3-methyl-6-oxo-1-[(2R)-5-oxooxolan-2-yl]hexyl]carbamate (PubChem CID 87490293) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-6-oxo-1-[(2R)-5-oxooxolan-2-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-6-oxo-1-[(2R)-5-oxooxolan-2-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 87490293 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | tert-butyl N-[3-methyl-6-oxo-1-[(2R)-5-oxooxolan-2-yl]hexyl]carbamate |
| SMILES | CC(CCC=O)CC(NC(=O)OC(C)(C)C)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C16H27NO5/c1-11(6-5-9-18)10-12(13-7-8-14(19)21-13)17-15(20)22-16(2,3)4/h9,11-13H,5-8,10H2,1-4H3,(H,17,20)/t11?,12?,13-/m1/s1 |
| InChIKey | FFFDGNPBSDIKDZ-WXRRBKDZSA-N |
| XLogP | 2.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|