C18H31NO4 — CID 58730359
tert-butyl N-[(1S)-3-methyl-1-[(2S,4S)-4-methyl-5-oxo-4-prop-2-enyloxolan-2-yl]butyl]carbamate (PubChem CID 58730359) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-methyl-1-[(2S,4S)-4-methyl-5-oxo-4-prop-2-enyloxolan-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-methyl-1-[(2S,4S)-4-methyl-5-oxo-4-prop-2-enyloxolan-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 58730359 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | tert-butyl N-[(1S)-3-methyl-1-[(2S,4S)-4-methyl-5-oxo-4-prop-2-enyloxolan-2-yl]butyl]carbamate |
| SMILES | C=CC[C@@]1(C)C[C@@H]([C@H](CC(C)C)NC(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C18H31NO4/c1-8-9-18(7)11-14(22-15(18)20)13(10-12(2)3)19-16(21)23-17(4,5)6/h8,12-14H,1,9-11H2,2-7H3,(H,19,21)/t13-,14-,18-/m0/s1 |
| InChIKey | FZYBWEZMWNFYGT-DEYYWGMASA-N |
| XLogP | 3.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|