C17H27NO7 — CID 54678471
tert-butyl N-[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-4-methylpentan-2-yl]carbamate (PubChem CID 54678471) has the molecular formula C17H27NO7 and a molecular weight of 357.40 g/mol. Its IUPAC name is tert-butyl N-[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-4-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 54678471 |
| Molecular Formula | C17H27NO7 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | tert-butyl N-[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-1-hydroxy-4-methylpentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(O)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H27NO7/c1-9(2)8-10(18-15(22)25-16(3,4)5)12(19)11-13(20)23-17(6,7)24-14(11)21/h9-10,19H,8H2,1-7H3,(H,18,22) |
| InChIKey | PWAAVFAVDFIHMU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|